About 3-methyl-8-methylidene-2,4,5,8a-tetrahydro-1H-azulen-6-one
3-methyl-8-methylidene-2,4,5,8a-tetrahydro-1H-azulen-6-one (PubChem CID 21434887) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 3-methyl-8-methylidene-2,4,5,8a-tetrahydro-1H-azulen-6-one.
Molecular Properties
| Compound Name | 3-methyl-8-methylidene-2,4,5,8a-tetrahydro-1H-azulen-6-one |
| PubChem CID | 21434887 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 3-methyl-8-methylidene-2,4,5,8a-tetrahydro-1H-azulen-6-one |
| SMILES | C=C1CC(=O)CCC2=C(C)CCC12 |
| InChI | InChI=1S/C12H16O/c1-8-3-5-12-9(2)7-10(13)4-6-11(8)12/h12H,2-7H2,1H3 |
| InChIKey | ZDWXQYRWBIFVJX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-8-methylidene-2,4,5,8a-tetrahydro-1H-azulen-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-8-methylidene-2,4,5,8a-tetrahydro-1H-azulen-6-one?
The IUPAC name of 3-methyl-8-methylidene-2,4,5,8a-tetrahydro-1H-azulen-6-one (CID 21434887) is 3-methyl-8-methylidene-2,4,5,8a-tetrahydro-1H-azulen-6-one.
What is the SMILES notation for 3-methyl-8-methylidene-2,4,5,8a-tetrahydro-1H-azulen-6-one?
The canonical SMILES for 3-methyl-8-methylidene-2,4,5,8a-tetrahydro-1H-azulen-6-one is C=C1CC(=O)CCC2=C(C)CCC12.
What is the InChIKey of 3-methyl-8-methylidene-2,4,5,8a-tetrahydro-1H-azulen-6-one?
The InChIKey is ZDWXQYRWBIFVJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c1-8-3-5-12-9(2)7-10(13)4-6-11(8)12/h12H,2-7H2,1H3.
What are the key properties of 3-methyl-8-methylidene-2,4,5,8a-tetrahydro-1H-azulen-6-one?
3-methyl-8-methylidene-2,4,5,8a-tetrahydro-1H-azulen-6-one has a molecular weight of 176.26 g/mol, XLogP of 3.02, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-8-methylidene-2,4,5,8a-tetrahydro-1H-azulen-6-one is sourced from PubChem (CID 21434887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).