About 4,10-dimethyl-7-propan-2-yl-11-oxatricyclo[6.2.1.01,5]undec-4-ene
4,10-dimethyl-7-propan-2-yl-11-oxatricyclo[6.2.1.01,5]undec-4-ene (PubChem CID 21434903) has the molecular formula C15H24O
and a molecular weight of 220.36 g/mol. Its IUPAC name is 4,10-dimethyl-7-propan-2-yl-11-oxatricyclo[6.2.1.01,5]undec-4-ene.
Molecular Properties
| Compound Name | 4,10-dimethyl-7-propan-2-yl-11-oxatricyclo[6.2.1.01,5]undec-4-ene |
| PubChem CID | 21434903 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 4,10-dimethyl-7-propan-2-yl-11-oxatricyclo[6.2.1.01,5]undec-4-ene |
| SMILES | CC1=C2CC(C(C)C)C3CC(C)C2(CC1)O3 |
| InChI | InChI=1S/C15H24O/c1-9(2)12-8-13-10(3)5-6-15(13)11(4)7-14(12)16-15/h9,11-12,14H,5-8H2,1-4H3 |
| InChIKey | JDRRMOFBGIAPRZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,10-dimethyl-7-propan-2-yl-11-oxatricyclo[6.2.1.01,5]undec-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,10-dimethyl-7-propan-2-yl-11-oxatricyclo[6.2.1.01,5]undec-4-ene?
The IUPAC name of 4,10-dimethyl-7-propan-2-yl-11-oxatricyclo[6.2.1.01,5]undec-4-ene (CID 21434903) is 4,10-dimethyl-7-propan-2-yl-11-oxatricyclo[6.2.1.01,5]undec-4-ene.
What is the SMILES notation for 4,10-dimethyl-7-propan-2-yl-11-oxatricyclo[6.2.1.01,5]undec-4-ene?
The canonical SMILES for 4,10-dimethyl-7-propan-2-yl-11-oxatricyclo[6.2.1.01,5]undec-4-ene is CC1=C2CC(C(C)C)C3CC(C)C2(CC1)O3.
What is the InChIKey of 4,10-dimethyl-7-propan-2-yl-11-oxatricyclo[6.2.1.01,5]undec-4-ene?
The InChIKey is JDRRMOFBGIAPRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O/c1-9(2)12-8-13-10(3)5-6-15(13)11(4)7-14(12)16-15/h9,11-12,14H,5-8H2,1-4H3.
What are the key properties of 4,10-dimethyl-7-propan-2-yl-11-oxatricyclo[6.2.1.01,5]undec-4-ene?
4,10-dimethyl-7-propan-2-yl-11-oxatricyclo[6.2.1.01,5]undec-4-ene has a molecular weight of 220.36 g/mol, XLogP of 3.94, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,10-dimethyl-7-propan-2-yl-11-oxatricyclo[6.2.1.01,5]undec-4-ene is sourced from PubChem (CID 21434903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).