C13H23N — CID 21436136
3-(2,3-dimethylcyclohexa-2,5-dien-1-yl)-N,N-dimethylpropan-1-amine (PubChem CID 21436136) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 3-(2,3-dimethylcyclohexa-2,5-dien-1-yl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(2,3-dimethylcyclohexa-2,5-dien-1-yl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 21436136 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 3-(2,3-dimethylcyclohexa-2,5-dien-1-yl)-N,N-dimethylpropan-1-amine |
| SMILES | CC1=C(C)C(CCCN(C)C)C=CC1 |
| InChI | InChI=1S/C13H23N/c1-11-7-5-8-13(12(11)2)9-6-10-14(3)4/h5,8,13H,6-7,9-10H2,1-4H3 |
| InChIKey | HIJVZLULTSUVLD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|