C15H22ClNO — CID 21436274
7-methoxy-5,5-dimethyl-1,2,3,4,4a,9b-hexahydroindeno[1,2-b]pyridine;hydrochloride (PubChem CID 21436274) has the molecular formula C15H22ClNO and a molecular weight of 267.80 g/mol. Its IUPAC name is 7-methoxy-5,5-dimethyl-1,2,3,4,4a,9b-hexahydroindeno[1,2-b]pyridine;hydrochloride.
| Compound Name | 7-methoxy-5,5-dimethyl-1,2,3,4,4a,9b-hexahydroindeno[1,2-b]pyridine;hydrochloride |
|---|---|
| PubChem CID | 21436274 |
| Molecular Formula | C15H22ClNO |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 7-methoxy-5,5-dimethyl-1,2,3,4,4a,9b-hexahydroindeno[1,2-b]pyridine;hydrochloride |
| SMILES | COc1ccc2c(c1)C(C)(C)C1CCCNC21.Cl |
| InChI | InChI=1S/C15H21NO.ClH/c1-15(2)12-5-4-8-16-14(12)11-7-6-10(17-3)9-13(11)15;/h6-7,9,12,14,16H,4-5,8H2,1-3H3;1H |
| InChIKey | DSVHWNHUGOMKTI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |