About 2-N-pyridin-2-ylpyridine-2,3,5-triamine
2-N-pyridin-2-ylpyridine-2,3,5-triamine (PubChem CID 21436318) has the molecular formula C10H11N5
and a molecular weight of 201.23 g/mol. Its IUPAC name is 2-N-pyridin-2-ylpyridine-2,3,5-triamine.
Molecular Properties
| Compound Name | 2-N-pyridin-2-ylpyridine-2,3,5-triamine |
| PubChem CID | 21436318 |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 2-N-pyridin-2-ylpyridine-2,3,5-triamine |
| SMILES | Nc1cnc(Nc2ccccn2)c(N)c1 |
| InChI | InChI=1S/C10H11N5/c11-7-5-8(12)10(14-6-7)15-9-3-1-2-4-13-9/h1-6H,11-12H2,(H,13,14,15) |
| InChIKey | HZEGUDONYXKGDJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-N-pyridin-2-ylpyridine-2,3,5-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-pyridin-2-ylpyridine-2,3,5-triamine?
The IUPAC name of 2-N-pyridin-2-ylpyridine-2,3,5-triamine (CID 21436318) is 2-N-pyridin-2-ylpyridine-2,3,5-triamine.
What is the SMILES notation for 2-N-pyridin-2-ylpyridine-2,3,5-triamine?
The canonical SMILES for 2-N-pyridin-2-ylpyridine-2,3,5-triamine is Nc1cnc(Nc2ccccn2)c(N)c1.
What is the InChIKey of 2-N-pyridin-2-ylpyridine-2,3,5-triamine?
The InChIKey is HZEGUDONYXKGDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N5/c11-7-5-8(12)10(14-6-7)15-9-3-1-2-4-13-9/h1-6H,11-12H2,(H,13,14,15).
What are the key properties of 2-N-pyridin-2-ylpyridine-2,3,5-triamine?
2-N-pyridin-2-ylpyridine-2,3,5-triamine has a molecular weight of 201.23 g/mol, XLogP of 1.38, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-pyridin-2-ylpyridine-2,3,5-triamine is sourced from PubChem (CID 21436318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).