About 4-(2,2-dinitroethenyl)-1,2-dimethylbenzene
4-(2,2-dinitroethenyl)-1,2-dimethylbenzene (PubChem CID 21436577) has the molecular formula C10H10N2O4
and a molecular weight of 222.20 g/mol. Its IUPAC name is 4-(2,2-dinitroethenyl)-1,2-dimethylbenzene.
Molecular Properties
| Compound Name | 4-(2,2-dinitroethenyl)-1,2-dimethylbenzene |
| PubChem CID | 21436577 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 4-(2,2-dinitroethenyl)-1,2-dimethylbenzene |
| SMILES | Cc1ccc(C=C([N+](=O)[O-])[N+](=O)[O-])cc1C |
| InChI | InChI=1S/C10H10N2O4/c1-7-3-4-9(5-8(7)2)6-10(11(13)14)12(15)16/h3-6H,1-2H3 |
| InChIKey | WTOQNAYOGJCDQD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2-dinitroethenyl)-1,2-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dinitroethenyl)-1,2-dimethylbenzene?
The IUPAC name of 4-(2,2-dinitroethenyl)-1,2-dimethylbenzene (CID 21436577) is 4-(2,2-dinitroethenyl)-1,2-dimethylbenzene.
What is the SMILES notation for 4-(2,2-dinitroethenyl)-1,2-dimethylbenzene?
The canonical SMILES for 4-(2,2-dinitroethenyl)-1,2-dimethylbenzene is Cc1ccc(C=C([N+](=O)[O-])[N+](=O)[O-])cc1C.
What is the InChIKey of 4-(2,2-dinitroethenyl)-1,2-dimethylbenzene?
The InChIKey is WTOQNAYOGJCDQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O4/c1-7-3-4-9(5-8(7)2)6-10(11(13)14)12(15)16/h3-6H,1-2H3.
What are the key properties of 4-(2,2-dinitroethenyl)-1,2-dimethylbenzene?
4-(2,2-dinitroethenyl)-1,2-dimethylbenzene has a molecular weight of 222.20 g/mol, XLogP of 2.16, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dinitroethenyl)-1,2-dimethylbenzene is sourced from PubChem (CID 21436577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).