About 9-hydroxy-2,8-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrochloride
9-hydroxy-2,8-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrochloride (PubChem CID 21436702) has the molecular formula C10H11ClN2O2
and a molecular weight of 226.66 g/mol. Its IUPAC name is 9-hydroxy-2,8-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrochloride.
Molecular Properties
| Compound Name | 9-hydroxy-2,8-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrochloride |
| PubChem CID | 21436702 |
| Molecular Formula | C10H11ClN2O2 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 9-hydroxy-2,8-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrochloride |
| SMILES | Cc1cc(=O)n2ccc(C)c(O)c2n1.Cl |
| InChI | InChI=1S/C10H10N2O2.ClH/c1-6-3-4-12-8(13)5-7(2)11-10(12)9(6)14;/h3-5,14H,1-2H3;1H |
| InChIKey | PAIFBQJYPQCOPJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-hydroxy-2,8-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydroxy-2,8-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrochloride?
The IUPAC name of 9-hydroxy-2,8-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrochloride (CID 21436702) is 9-hydroxy-2,8-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrochloride.
What is the SMILES notation for 9-hydroxy-2,8-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrochloride?
The canonical SMILES for 9-hydroxy-2,8-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrochloride is Cc1cc(=O)n2ccc(C)c(O)c2n1.Cl.
What is the InChIKey of 9-hydroxy-2,8-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrochloride?
The InChIKey is PAIFBQJYPQCOPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2.ClH/c1-6-3-4-12-8(13)5-7(2)11-10(12)9(6)14;/h3-5,14H,1-2H3;1H.
What are the key properties of 9-hydroxy-2,8-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrochloride?
9-hydroxy-2,8-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrochloride has a molecular weight of 226.66 g/mol, XLogP of 1.44, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroxy-2,8-dimethylpyrido[1,2-a]pyrimidin-4-one;hydrochloride is sourced from PubChem (CID 21436702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).