About 2-[3-(hydroxymethyl)-5,6-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]acetonitrile
2-[3-(hydroxymethyl)-5,6-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]acetonitrile (PubChem CID 21437384) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 2-[3-(hydroxymethyl)-5,6-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[3-(hydroxymethyl)-5,6-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]acetonitrile |
| PubChem CID | 21437384 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 2-[3-(hydroxymethyl)-5,6-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]acetonitrile |
| SMILES | CC1=C(C)C2CC1C(CO)C2CC#N |
| InChI | InChI=1S/C12H17NO/c1-7-8(2)11-5-10(7)9(3-4-13)12(11)6-14/h9-12,14H,3,5-6H2,1-2H3 |
| InChIKey | NYERCVDDFWIYDX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(hydroxymethyl)-5,6-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(hydroxymethyl)-5,6-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]acetonitrile?
The IUPAC name of 2-[3-(hydroxymethyl)-5,6-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]acetonitrile (CID 21437384) is 2-[3-(hydroxymethyl)-5,6-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]acetonitrile.
What is the SMILES notation for 2-[3-(hydroxymethyl)-5,6-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]acetonitrile?
The canonical SMILES for 2-[3-(hydroxymethyl)-5,6-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]acetonitrile is CC1=C(C)C2CC1C(CO)C2CC#N.
What is the InChIKey of 2-[3-(hydroxymethyl)-5,6-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]acetonitrile?
The InChIKey is NYERCVDDFWIYDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-7-8(2)11-5-10(7)9(3-4-13)12(11)6-14/h9-12,14H,3,5-6H2,1-2H3.
What are the key properties of 2-[3-(hydroxymethyl)-5,6-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]acetonitrile?
2-[3-(hydroxymethyl)-5,6-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]acetonitrile has a molecular weight of 191.27 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(hydroxymethyl)-5,6-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]acetonitrile is sourced from PubChem (CID 21437384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).