About 4-(2,5-diethoxy-2H-furan-5-yl)butanal
4-(2,5-diethoxy-2H-furan-5-yl)butanal (PubChem CID 21437431) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is 4-(2,5-diethoxy-2H-furan-5-yl)butanal.
Molecular Properties
| Compound Name | 4-(2,5-diethoxy-2H-furan-5-yl)butanal |
| PubChem CID | 21437431 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 4-(2,5-diethoxy-2H-furan-5-yl)butanal |
| SMILES | CCOC1C=CC(CCCC=O)(OCC)O1 |
| InChI | InChI=1S/C12H20O4/c1-3-14-11-7-9-12(16-11,15-4-2)8-5-6-10-13/h7,9-11H,3-6,8H2,1-2H3 |
| InChIKey | SPVBJINVULNESA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,5-diethoxy-2H-furan-5-yl)butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-diethoxy-2H-furan-5-yl)butanal?
The IUPAC name of 4-(2,5-diethoxy-2H-furan-5-yl)butanal (CID 21437431) is 4-(2,5-diethoxy-2H-furan-5-yl)butanal.
What is the SMILES notation for 4-(2,5-diethoxy-2H-furan-5-yl)butanal?
The canonical SMILES for 4-(2,5-diethoxy-2H-furan-5-yl)butanal is CCOC1C=CC(CCCC=O)(OCC)O1.
What is the InChIKey of 4-(2,5-diethoxy-2H-furan-5-yl)butanal?
The InChIKey is SPVBJINVULNESA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c1-3-14-11-7-9-12(16-11,15-4-2)8-5-6-10-13/h7,9-11H,3-6,8H2,1-2H3.
What are the key properties of 4-(2,5-diethoxy-2H-furan-5-yl)butanal?
4-(2,5-diethoxy-2H-furan-5-yl)butanal has a molecular weight of 228.29 g/mol, XLogP of 2.04, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-diethoxy-2H-furan-5-yl)butanal is sourced from PubChem (CID 21437431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).