C23H28N4O5 — CID 21437847
4-[4-(diaminomethylideneamino)benzoyl]oxy-2-[2-(dipropylamino)-2-oxoethyl]benzoic acid (PubChem CID 21437847) has the molecular formula C23H28N4O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is 4-[4-(diaminomethylideneamino)benzoyl]oxy-2-[2-(dipropylamino)-2-oxoethyl]benzoic acid.
| Compound Name | 4-[4-(diaminomethylideneamino)benzoyl]oxy-2-[2-(dipropylamino)-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 21437847 |
| Molecular Formula | C23H28N4O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 4-[4-(diaminomethylideneamino)benzoyl]oxy-2-[2-(dipropylamino)-2-oxoethyl]benzoic acid |
| SMILES | CCCN(CCC)C(=O)Cc1cc(OC(=O)c2ccc(N=C(N)N)cc2)ccc1C(=O)O |
| InChI | InChI=1S/C23H28N4O5/c1-3-11-27(12-4-2)20(28)14-16-13-18(9-10-19(16)21(29)30)32-22(31)15-5-7-17(8-6-15)26-23(24)25/h5-10,13H,3-4,11-12,14H2,1-2H3,(H,29,30)(H4,24,25,26) |
| InChIKey | MEITZRYEAFJXHU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|