About spiro[1,3-dihydroisochromene-4,3'-oxirane]-2'-carbonitrile
spiro[1,3-dihydroisochromene-4,3'-oxirane]-2'-carbonitrile (PubChem CID 21437901) has the molecular formula C11H9NO2
and a molecular weight of 187.20 g/mol. Its IUPAC name is spiro[1,3-dihydroisochromene-4,3'-oxirane]-2'-carbonitrile.
Molecular Properties
| Compound Name | spiro[1,3-dihydroisochromene-4,3'-oxirane]-2'-carbonitrile |
| PubChem CID | 21437901 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | spiro[1,3-dihydroisochromene-4,3'-oxirane]-2'-carbonitrile |
| SMILES | N#CC1OC12COCc1ccccc12 |
| InChI | InChI=1S/C11H9NO2/c12-5-10-11(14-10)7-13-6-8-3-1-2-4-9(8)11/h1-4,10H,6-7H2 |
| InChIKey | JMWGKESDCYTZPU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze spiro[1,3-dihydroisochromene-4,3'-oxirane]-2'-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-dihydroisochromene-4,3'-oxirane]-2'-carbonitrile?
The IUPAC name of spiro[1,3-dihydroisochromene-4,3'-oxirane]-2'-carbonitrile (CID 21437901) is spiro[1,3-dihydroisochromene-4,3'-oxirane]-2'-carbonitrile.
What is the SMILES notation for spiro[1,3-dihydroisochromene-4,3'-oxirane]-2'-carbonitrile?
The canonical SMILES for spiro[1,3-dihydroisochromene-4,3'-oxirane]-2'-carbonitrile is N#CC1OC12COCc1ccccc12.
What is the InChIKey of spiro[1,3-dihydroisochromene-4,3'-oxirane]-2'-carbonitrile?
The InChIKey is JMWGKESDCYTZPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2/c12-5-10-11(14-10)7-13-6-8-3-1-2-4-9(8)11/h1-4,10H,6-7H2.
What are the key properties of spiro[1,3-dihydroisochromene-4,3'-oxirane]-2'-carbonitrile?
spiro[1,3-dihydroisochromene-4,3'-oxirane]-2'-carbonitrile has a molecular weight of 187.20 g/mol, XLogP of 1.33, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-dihydroisochromene-4,3'-oxirane]-2'-carbonitrile is sourced from PubChem (CID 21437901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).