About 6-methyl-11-(3-pyrrolidin-1-ylpropyl)pyrido[3,2-c][1,5]benzodiazepin-5-one;hydrochloride
6-methyl-11-(3-pyrrolidin-1-ylpropyl)pyrido[3,2-c][1,5]benzodiazepin-5-one;hydrochloride (PubChem CID 21438325) has the molecular formula C20H25ClN4O
and a molecular weight of 372.90 g/mol. Its IUPAC name is 6-methyl-11-(3-pyrrolidin-1-ylpropyl)pyrido[3,2-c][1,5]benzodiazepin-5-one;hydrochloride.
Molecular Properties
| Compound Name | 6-methyl-11-(3-pyrrolidin-1-ylpropyl)pyrido[3,2-c][1,5]benzodiazepin-5-one;hydrochloride |
| PubChem CID | 21438325 |
| Molecular Formula | C20H25ClN4O |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 6-methyl-11-(3-pyrrolidin-1-ylpropyl)pyrido[3,2-c][1,5]benzodiazepin-5-one;hydrochloride |
| SMILES | CN1C(=O)c2cccnc2N(CCCN2CCCC2)c2ccccc21.Cl |
| InChI | InChI=1S/C20H24N4O.ClH/c1-22-17-9-2-3-10-18(17)24(15-7-14-23-12-4-5-13-23)19-16(20(22)25)8-6-11-21-19;/h2-3,6,8-11H,4-5,7,12-15H2,1H3;1H |
| InChIKey | XSLULAOUFFESEX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-11-(3-pyrrolidin-1-ylpropyl)pyrido[3,2-c][1,5]benzodiazepin-5-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-11-(3-pyrrolidin-1-ylpropyl)pyrido[3,2-c][1,5]benzodiazepin-5-one;hydrochloride?
The IUPAC name of 6-methyl-11-(3-pyrrolidin-1-ylpropyl)pyrido[3,2-c][1,5]benzodiazepin-5-one;hydrochloride (CID 21438325) is 6-methyl-11-(3-pyrrolidin-1-ylpropyl)pyrido[3,2-c][1,5]benzodiazepin-5-one;hydrochloride.
What is the SMILES notation for 6-methyl-11-(3-pyrrolidin-1-ylpropyl)pyrido[3,2-c][1,5]benzodiazepin-5-one;hydrochloride?
The canonical SMILES for 6-methyl-11-(3-pyrrolidin-1-ylpropyl)pyrido[3,2-c][1,5]benzodiazepin-5-one;hydrochloride is CN1C(=O)c2cccnc2N(CCCN2CCCC2)c2ccccc21.Cl.
What is the InChIKey of 6-methyl-11-(3-pyrrolidin-1-ylpropyl)pyrido[3,2-c][1,5]benzodiazepin-5-one;hydrochloride?
The InChIKey is XSLULAOUFFESEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4O.ClH/c1-22-17-9-2-3-10-18(17)24(15-7-14-23-12-4-5-13-23)19-16(20(22)25)8-6-11-21-19;/h2-3,6,8-11H,4-5,7,12-15H2,1H3;1H.
What are the key properties of 6-methyl-11-(3-pyrrolidin-1-ylpropyl)pyrido[3,2-c][1,5]benzodiazepin-5-one;hydrochloride?
6-methyl-11-(3-pyrrolidin-1-ylpropyl)pyrido[3,2-c][1,5]benzodiazepin-5-one;hydrochloride has a molecular weight of 372.90 g/mol, XLogP of 3.72, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-11-(3-pyrrolidin-1-ylpropyl)pyrido[3,2-c][1,5]benzodiazepin-5-one;hydrochloride is sourced from PubChem (CID 21438325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).