C15H13Cl2NO2S — CID 21438612
2-[[4-(2,2-dichlorocyclopropyl)phenyl]methylsulfonyl]pyridine (PubChem CID 21438612) has the molecular formula C15H13Cl2NO2S and a molecular weight of 342.25 g/mol. Its IUPAC name is 2-[[4-(2,2-dichlorocyclopropyl)phenyl]methylsulfonyl]pyridine.
| Compound Name | 2-[[4-(2,2-dichlorocyclopropyl)phenyl]methylsulfonyl]pyridine |
|---|---|
| PubChem CID | 21438612 |
| Molecular Formula | C15H13Cl2NO2S |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 2-[[4-(2,2-dichlorocyclopropyl)phenyl]methylsulfonyl]pyridine |
| SMILES | O=S(=O)(Cc1ccc(C2CC2(Cl)Cl)cc1)c1ccccn1 |
| InChI | InChI=1S/C15H13Cl2NO2S/c16-15(17)9-13(15)12-6-4-11(5-7-12)10-21(19,20)14-3-1-2-8-18-14/h1-8,13H,9-10H2 |
| InChIKey | LUWBDNJBPNCAMI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|