About N-phenylbenzo[c][5,1,2]benzoxadiazepin-2-amine
N-phenylbenzo[c][5,1,2]benzoxadiazepin-2-amine (PubChem CID 21438867) has the molecular formula C18H13N3O
and a molecular weight of 287.32 g/mol. Its IUPAC name is N-phenylbenzo[c][5,1,2]benzoxadiazepin-2-amine.
Molecular Properties
| Compound Name | N-phenylbenzo[c][5,1,2]benzoxadiazepin-2-amine |
| PubChem CID | 21438867 |
| Molecular Formula | C18H13N3O |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | N-phenylbenzo[c][5,1,2]benzoxadiazepin-2-amine |
| SMILES | c1ccc(Nc2ccc3c(c2)Oc2ccccc2N=N3)cc1 |
| InChI | InChI=1S/C18H13N3O/c1-2-6-13(7-3-1)19-14-10-11-16-18(12-14)22-17-9-5-4-8-15(17)20-21-16/h1-12,19H |
| InChIKey | UUEFBJWIEXGBHZ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-phenylbenzo[c][5,1,2]benzoxadiazepin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenylbenzo[c][5,1,2]benzoxadiazepin-2-amine?
The IUPAC name of N-phenylbenzo[c][5,1,2]benzoxadiazepin-2-amine (CID 21438867) is N-phenylbenzo[c][5,1,2]benzoxadiazepin-2-amine.
What is the SMILES notation for N-phenylbenzo[c][5,1,2]benzoxadiazepin-2-amine?
The canonical SMILES for N-phenylbenzo[c][5,1,2]benzoxadiazepin-2-amine is c1ccc(Nc2ccc3c(c2)Oc2ccccc2N=N3)cc1.
What is the InChIKey of N-phenylbenzo[c][5,1,2]benzoxadiazepin-2-amine?
The InChIKey is UUEFBJWIEXGBHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N3O/c1-2-6-13(7-3-1)19-14-10-11-16-18(12-14)22-17-9-5-4-8-15(17)20-21-16/h1-12,19H.
What are the key properties of N-phenylbenzo[c][5,1,2]benzoxadiazepin-2-amine?
N-phenylbenzo[c][5,1,2]benzoxadiazepin-2-amine has a molecular weight of 287.32 g/mol, XLogP of 5.95, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylbenzo[c][5,1,2]benzoxadiazepin-2-amine is sourced from PubChem (CID 21438867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).