About (2-aminophenyl)methanol
(2-aminophenyl)methanol (PubChem CID 21439) has the molecular formula C7H9NO
and a molecular weight of 123.15 g/mol. Its IUPAC name is (2-aminophenyl)methanol.
Molecular Properties
| Compound Name | (2-aminophenyl)methanol |
| PubChem CID | 21439 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | (2-aminophenyl)methanol |
| SMILES | Nc1ccccc1CO |
| InChI | InChI=1S/C7H9NO/c8-7-4-2-1-3-6(7)5-9/h1-4,9H,5,8H2 |
| InChIKey | VYFOAVADNIHPTR-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2-aminophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminophenyl)methanol?
The IUPAC name of (2-aminophenyl)methanol (CID 21439) is (2-aminophenyl)methanol.
What is the SMILES notation for (2-aminophenyl)methanol?
The canonical SMILES for (2-aminophenyl)methanol is Nc1ccccc1CO.
What is the InChIKey of (2-aminophenyl)methanol?
The InChIKey is VYFOAVADNIHPTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO/c8-7-4-2-1-3-6(7)5-9/h1-4,9H,5,8H2.
What are the key properties of (2-aminophenyl)methanol?
(2-aminophenyl)methanol has a molecular weight of 123.15 g/mol, XLogP of 0.76, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminophenyl)methanol is sourced from PubChem (CID 21439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).