About 4-chloro-2-(1H-1,2,4-triazol-5-yl)aniline
4-chloro-2-(1H-1,2,4-triazol-5-yl)aniline (PubChem CID 21439075) has the molecular formula C8H7ClN4
and a molecular weight of 194.63 g/mol. Its IUPAC name is 4-chloro-2-(1H-1,2,4-triazol-5-yl)aniline.
Molecular Properties
| Compound Name | 4-chloro-2-(1H-1,2,4-triazol-5-yl)aniline |
| PubChem CID | 21439075 |
| Molecular Formula | C8H7ClN4 |
| Molecular Weight | 194.63 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 4-chloro-2-(1H-1,2,4-triazol-5-yl)aniline |
| SMILES | Nc1ccc(Cl)cc1-c1ncn[nH]1 |
| InChI | InChI=1S/C8H7ClN4/c9-5-1-2-7(10)6(3-5)8-11-4-12-13-8/h1-4H,10H2,(H,11,12,13) |
| InChIKey | YLZNCOGLABONRN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.63 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-(1H-1,2,4-triazol-5-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(1H-1,2,4-triazol-5-yl)aniline?
The IUPAC name of 4-chloro-2-(1H-1,2,4-triazol-5-yl)aniline (CID 21439075) is 4-chloro-2-(1H-1,2,4-triazol-5-yl)aniline.
What is the SMILES notation for 4-chloro-2-(1H-1,2,4-triazol-5-yl)aniline?
The canonical SMILES for 4-chloro-2-(1H-1,2,4-triazol-5-yl)aniline is Nc1ccc(Cl)cc1-c1ncn[nH]1.
What is the InChIKey of 4-chloro-2-(1H-1,2,4-triazol-5-yl)aniline?
The InChIKey is YLZNCOGLABONRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN4/c9-5-1-2-7(10)6(3-5)8-11-4-12-13-8/h1-4H,10H2,(H,11,12,13).
What are the key properties of 4-chloro-2-(1H-1,2,4-triazol-5-yl)aniline?
4-chloro-2-(1H-1,2,4-triazol-5-yl)aniline has a molecular weight of 194.63 g/mol, XLogP of 1.71, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(1H-1,2,4-triazol-5-yl)aniline is sourced from PubChem (CID 21439075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).