C18H18O2S — CID 21439335
5-(3,5-dimethylphenyl)-6-phenyl-2,3-dihydro-1,4-oxathiine 4-oxide (PubChem CID 21439335) has the molecular formula C18H18O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is 5-(3,5-dimethylphenyl)-6-phenyl-2,3-dihydro-1,4-oxathiine 4-oxide.
| Compound Name | 5-(3,5-dimethylphenyl)-6-phenyl-2,3-dihydro-1,4-oxathiine 4-oxide |
|---|---|
| PubChem CID | 21439335 |
| Molecular Formula | C18H18O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 5-(3,5-dimethylphenyl)-6-phenyl-2,3-dihydro-1,4-oxathiine 4-oxide |
| SMILES | Cc1cc(C)cc(C2=C(c3ccccc3)OCCS2=O)c1 |
| InChI | InChI=1S/C18H18O2S/c1-13-10-14(2)12-16(11-13)18-17(20-8-9-21(18)19)15-6-4-3-5-7-15/h3-7,10-12H,8-9H2,1-2H3 |
| InChIKey | RXAGXTLXYIZAEI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|