C14H12ClF3N4O3S — CID 21440097
[1-methyl-3-oxido-3-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]imidazolidin-3-ium-4-yl] 4-chlorobenzoate (PubChem CID 21440097) has the molecular formula C14H12ClF3N4O3S and a molecular weight of 408.79 g/mol. Its IUPAC name is [1-methyl-3-oxido-3-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]imidazolidin-3-ium-4-yl] 4-chlorobenzoate.
| Compound Name | [1-methyl-3-oxido-3-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]imidazolidin-3-ium-4-yl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 21440097 |
| Molecular Formula | C14H12ClF3N4O3S |
| Molecular Weight | 408.79 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | [1-methyl-3-oxido-3-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]imidazolidin-3-ium-4-yl] 4-chlorobenzoate |
| SMILES | CN1CC(OC(=O)c2ccc(Cl)cc2)[N+]([O-])(c2nnc(C(F)(F)F)s2)C1 |
| InChI | InChI=1S/C14H12ClF3N4O3S/c1-21-6-10(25-11(23)8-2-4-9(15)5-3-8)22(24,7-21)13-20-19-12(26-13)14(16,17)18/h2-5,10H,6-7H2,1H3 |
| InChIKey | GZWIKNPKMJWNSJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.79 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|