C28H43N3S — CID 21441331
3-N,3-N,7-N,7-N-tetrabutyl-10H-phenothiazine-3,7-diamine (PubChem CID 21441331) has the molecular formula C28H43N3S and a molecular weight of 453.74 g/mol. Its IUPAC name is 3-N,3-N,7-N,7-N-tetrabutyl-10H-phenothiazine-3,7-diamine.
| Compound Name | 3-N,3-N,7-N,7-N-tetrabutyl-10H-phenothiazine-3,7-diamine |
|---|---|
| PubChem CID | 21441331 |
| Molecular Formula | C28H43N3S |
| Molecular Weight | 453.74 g/mol |
| Exact Mass | 453.32 |
| IUPAC Name | 3-N,3-N,7-N,7-N-tetrabutyl-10H-phenothiazine-3,7-diamine |
| SMILES | CCCCN(CCCC)c1ccc2c(c1)Sc1cc(N(CCCC)CCCC)ccc1N2 |
| InChI | InChI=1S/C28H43N3S/c1-5-9-17-30(18-10-6-2)23-13-15-25-27(21-23)32-28-22-24(14-16-26(28)29-25)31(19-11-7-3)20-12-8-4/h13-16,21-22,29H,5-12,17-20H2,1-4H3 |
| InChIKey | XXYYWJSQCLJKBB-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.74 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |