C9H13NO2 — CID 21441431
6-methoxy-3,4,4a,5-tetrahydro-2H-1,4-benzoxazine (PubChem CID 21441431) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 6-methoxy-3,4,4a,5-tetrahydro-2H-1,4-benzoxazine.
| Compound Name | 6-methoxy-3,4,4a,5-tetrahydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 21441431 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 6-methoxy-3,4,4a,5-tetrahydro-2H-1,4-benzoxazine |
| SMILES | COC1=CC=C2OCCNC2C1 |
| InChI | InChI=1S/C9H13NO2/c1-11-7-2-3-9-8(6-7)10-4-5-12-9/h2-3,8,10H,4-6H2,1H3 |
| InChIKey | QVHCNWJSIWYYJF-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |