C25H29ClN6O3 — CID 21441652
(2Z)-2-[(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)hydrazinylidene]-4-[4-(2-hydroxyethyl)piperazin-1-yl]butanoic acid (PubChem CID 21441652) has the molecular formula C25H29ClN6O3 and a molecular weight of 497.00 g/mol. Its IUPAC name is (2Z)-2-[(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)hydrazinylidene]-4-[4-(2-hydroxyethyl)piperazin-1-yl]butanoic acid.
| Compound Name | (2Z)-2-[(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)hydrazinylidene]-4-[4-(2-hydroxyethyl)piperazin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 21441652 |
| Molecular Formula | C25H29ClN6O3 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | (2Z)-2-[(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)hydrazinylidene]-4-[4-(2-hydroxyethyl)piperazin-1-yl]butanoic acid |
| SMILES | O=C(O)/C(CCN1CCN(CCO)CC1)=N\NC1=Nc2ccc(Cl)cc2C(c2ccccc2)=NC1 |
| InChI | InChI=1S/C25H29ClN6O3/c26-19-6-7-21-20(16-19)24(18-4-2-1-3-5-18)27-17-23(28-21)30-29-22(25(34)35)8-9-31-10-12-32(13-11-31)14-15-33/h1-7,16,33H,8-15,17H2,(H,28,30)(H,34,35)/b29-22- |
| InChIKey | LUHDIBBLSHFTQO-IADYIPOJSA-N |
| XLogP | 2.25 |
| TPSA | 113.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|