C24H44OS — CID 21441822
2-(3,7,11,15-tetramethylhexadecoxy)thiophene (PubChem CID 21441822) has the molecular formula C24H44OS and a molecular weight of 380.68 g/mol. Its IUPAC name is 2-(3,7,11,15-tetramethylhexadecoxy)thiophene.
| Compound Name | 2-(3,7,11,15-tetramethylhexadecoxy)thiophene |
|---|---|
| PubChem CID | 21441822 |
| Molecular Formula | C24H44OS |
| Molecular Weight | 380.68 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | 2-(3,7,11,15-tetramethylhexadecoxy)thiophene |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CCOc1cccs1 |
| InChI | InChI=1S/C24H44OS/c1-20(2)10-6-11-21(3)12-7-13-22(4)14-8-15-23(5)17-18-25-24-16-9-19-26-24/h9,16,19-23H,6-8,10-15,17-18H2,1-5H3 |
| InChIKey | AQRBPANUFFRQOI-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.68 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |