About octyl N-carbamoyl-N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]carbamimidate
octyl N-carbamoyl-N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]carbamimidate (PubChem CID 21441930) has the molecular formula C17H24Cl2N4O3S
and a molecular weight of 435.38 g/mol. Its IUPAC name is octyl N-carbamoyl-N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]carbamimidate.
Molecular Properties
| Compound Name | octyl N-carbamoyl-N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]carbamimidate |
| PubChem CID | 21441930 |
| Molecular Formula | C17H24Cl2N4O3S |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | octyl N-carbamoyl-N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]carbamimidate |
| SMILES | [H]/N=C(\OCCCCCCCC)N(C(N)=O)C(=O)NSc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H24Cl2N4O3S/c1-2-3-4-5-6-7-10-26-16(21)23(15(20)24)17(25)22-27-12-8-9-13(18)14(19)11-12/h8-9,11,21H,2-7,10H2,1H3,(H2,20,24)(H,22,25)/b21-16- |
| InChIKey | PVPLQNUFFYHNIM-PGMHBOJBSA-N |
| XLogP | 5.40 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze octyl N-carbamoyl-N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]carbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octyl N-carbamoyl-N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]carbamimidate?
The IUPAC name of octyl N-carbamoyl-N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]carbamimidate (CID 21441930) is octyl N-carbamoyl-N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]carbamimidate.
What is the SMILES notation for octyl N-carbamoyl-N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]carbamimidate?
The canonical SMILES for octyl N-carbamoyl-N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]carbamimidate is [H]/N=C(\OCCCCCCCC)N(C(N)=O)C(=O)NSc1ccc(Cl)c(Cl)c1.
What is the InChIKey of octyl N-carbamoyl-N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]carbamimidate?
The InChIKey is PVPLQNUFFYHNIM-PGMHBOJBSA-N. The full InChI is InChI=1S/C17H24Cl2N4O3S/c1-2-3-4-5-6-7-10-26-16(21)23(15(20)24)17(25)22-27-12-8-9-13(18)14(19)11-12/h8-9,11,21H,2-7,10H2,1H3,(H2,20,24)(H,22,25)/b21-16-.
What are the key properties of octyl N-carbamoyl-N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]carbamimidate?
octyl N-carbamoyl-N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]carbamimidate has a molecular weight of 435.38 g/mol, XLogP of 5.40, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for octyl N-carbamoyl-N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]carbamimidate is sourced from PubChem (CID 21441930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).