C17H14N4O2S — CID 21442718
4,5-dimethyl-7-phenyl-3-thia-1,8,11,13-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene-12-carboxylic acid (PubChem CID 21442718) has the molecular formula C17H14N4O2S and a molecular weight of 338.39 g/mol. Its IUPAC name is 4,5-dimethyl-7-phenyl-3-thia-1,8,11,13-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene-12-carboxylic acid.
| Compound Name | 4,5-dimethyl-7-phenyl-3-thia-1,8,11,13-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene-12-carboxylic acid |
|---|---|
| PubChem CID | 21442718 |
| Molecular Formula | C17H14N4O2S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 4,5-dimethyl-7-phenyl-3-thia-1,8,11,13-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene-12-carboxylic acid |
| SMILES | Cc1sc2c(c1C)C(c1ccccc1)=NCc1nc(C(=O)O)nn1-2 |
| InChI | InChI=1S/C17H14N4O2S/c1-9-10(2)24-16-13(9)14(11-6-4-3-5-7-11)18-8-12-19-15(17(22)23)20-21(12)16/h3-7H,8H2,1-2H3,(H,22,23) |
| InChIKey | GWAYLVAIBGLULL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |