About 5,6-dichlorocyclohexa-1,5-dien-1-ol
5,6-dichlorocyclohexa-1,5-dien-1-ol (PubChem CID 21443528) has the molecular formula C6H6Cl2O
and a molecular weight of 165.02 g/mol. Its IUPAC name is 5,6-dichlorocyclohexa-1,5-dien-1-ol.
Molecular Properties
| Compound Name | 5,6-dichlorocyclohexa-1,5-dien-1-ol |
| PubChem CID | 21443528 |
| Molecular Formula | C6H6Cl2O |
| Molecular Weight | 165.02 g/mol |
| Exact Mass | 163.98 |
| IUPAC Name | 5,6-dichlorocyclohexa-1,5-dien-1-ol |
| SMILES | OC1=CCCC(Cl)=C1Cl |
| InChI | InChI=1S/C6H6Cl2O/c7-4-2-1-3-5(9)6(4)8/h3,9H,1-2H2 |
| InChIKey | WRMNFUKCQOSUHH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.02 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,6-dichlorocyclohexa-1,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dichlorocyclohexa-1,5-dien-1-ol?
The IUPAC name of 5,6-dichlorocyclohexa-1,5-dien-1-ol (CID 21443528) is 5,6-dichlorocyclohexa-1,5-dien-1-ol.
What is the SMILES notation for 5,6-dichlorocyclohexa-1,5-dien-1-ol?
The canonical SMILES for 5,6-dichlorocyclohexa-1,5-dien-1-ol is OC1=CCCC(Cl)=C1Cl.
What is the InChIKey of 5,6-dichlorocyclohexa-1,5-dien-1-ol?
The InChIKey is WRMNFUKCQOSUHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6Cl2O/c7-4-2-1-3-5(9)6(4)8/h3,9H,1-2H2.
What are the key properties of 5,6-dichlorocyclohexa-1,5-dien-1-ol?
5,6-dichlorocyclohexa-1,5-dien-1-ol has a molecular weight of 165.02 g/mol, XLogP of 2.91, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dichlorocyclohexa-1,5-dien-1-ol is sourced from PubChem (CID 21443528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).