C12H10Br2N2 — CID 21443613
5,6-dibromo-7,10-diazatricyclo[8.4.0.02,7]tetradeca-1,3,5,11,13-pentaene (PubChem CID 21443613) has the molecular formula C12H10Br2N2 and a molecular weight of 342.03 g/mol. Its IUPAC name is 5,6-dibromo-7,10-diazatricyclo[8.4.0.02,7]tetradeca-1,3,5,11,13-pentaene.
| Compound Name | 5,6-dibromo-7,10-diazatricyclo[8.4.0.02,7]tetradeca-1,3,5,11,13-pentaene |
|---|---|
| PubChem CID | 21443613 |
| Molecular Formula | C12H10Br2N2 |
| Molecular Weight | 342.03 g/mol |
| Exact Mass | 339.92 |
| IUPAC Name | 5,6-dibromo-7,10-diazatricyclo[8.4.0.02,7]tetradeca-1,3,5,11,13-pentaene |
| SMILES | BrC1=C(Br)N2CCN3C=CC=CC3=C2C=C1 |
| InChI | InChI=1S/C12H10Br2N2/c13-9-4-5-11-10-3-1-2-6-15(10)7-8-16(11)12(9)14/h1-6H,7-8H2 |
| InChIKey | WIVMIMCSTWBPFF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.03 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|