About acetic acid;2-(dibutylamino)ethanol
acetic acid;2-(dibutylamino)ethanol (PubChem CID 21443790) has the molecular formula C12H27NO3
and a molecular weight of 233.35 g/mol. Its IUPAC name is acetic acid;2-(dibutylamino)ethanol.
Molecular Properties
| Compound Name | acetic acid;2-(dibutylamino)ethanol |
| PubChem CID | 21443790 |
| Molecular Formula | C12H27NO3 |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.20 |
| IUPAC Name | acetic acid;2-(dibutylamino)ethanol |
| SMILES | CC(=O)O.CCCCN(CCO)CCCC |
| InChI | InChI=1S/C10H23NO.C2H4O2/c1-3-5-7-11(9-10-12)8-6-4-2;1-2(3)4/h12H,3-10H2,1-2H3;1H3,(H,3,4) |
| InChIKey | ZZXYBVFEQUTZPZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetic acid;2-(dibutylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2-(dibutylamino)ethanol?
The IUPAC name of acetic acid;2-(dibutylamino)ethanol (CID 21443790) is acetic acid;2-(dibutylamino)ethanol.
What is the SMILES notation for acetic acid;2-(dibutylamino)ethanol?
The canonical SMILES for acetic acid;2-(dibutylamino)ethanol is CC(=O)O.CCCCN(CCO)CCCC.
What is the InChIKey of acetic acid;2-(dibutylamino)ethanol?
The InChIKey is ZZXYBVFEQUTZPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO.C2H4O2/c1-3-5-7-11(9-10-12)8-6-4-2;1-2(3)4/h12H,3-10H2,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;2-(dibutylamino)ethanol?
acetic acid;2-(dibutylamino)ethanol has a molecular weight of 233.35 g/mol, XLogP of 1.97, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-(dibutylamino)ethanol is sourced from PubChem (CID 21443790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).