About cyano-(3,5-dimethylphenyl)cyanamide
cyano-(3,5-dimethylphenyl)cyanamide (PubChem CID 21443857) has the molecular formula C10H9N3
and a molecular weight of 171.20 g/mol. Its IUPAC name is cyano-(3,5-dimethylphenyl)cyanamide.
Molecular Properties
| Compound Name | cyano-(3,5-dimethylphenyl)cyanamide |
| PubChem CID | 21443857 |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | cyano-(3,5-dimethylphenyl)cyanamide |
| SMILES | Cc1cc(C)cc(N(C#N)C#N)c1 |
| InChI | InChI=1S/C10H9N3/c1-8-3-9(2)5-10(4-8)13(6-11)7-12/h3-5H,1-2H3 |
| InChIKey | GTTLUCVNQCSHBP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze cyano-(3,5-dimethylphenyl)cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyano-(3,5-dimethylphenyl)cyanamide?
The IUPAC name of cyano-(3,5-dimethylphenyl)cyanamide (CID 21443857) is cyano-(3,5-dimethylphenyl)cyanamide.
What is the SMILES notation for cyano-(3,5-dimethylphenyl)cyanamide?
The canonical SMILES for cyano-(3,5-dimethylphenyl)cyanamide is Cc1cc(C)cc(N(C#N)C#N)c1.
What is the InChIKey of cyano-(3,5-dimethylphenyl)cyanamide?
The InChIKey is GTTLUCVNQCSHBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3/c1-8-3-9(2)5-10(4-8)13(6-11)7-12/h3-5H,1-2H3.
What are the key properties of cyano-(3,5-dimethylphenyl)cyanamide?
cyano-(3,5-dimethylphenyl)cyanamide has a molecular weight of 171.20 g/mol, XLogP of 2.07, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyano-(3,5-dimethylphenyl)cyanamide is sourced from PubChem (CID 21443857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).