C22H30O11P2 — CID 21443872
1,2-bis[bis(ethylperoxy)phosphorylmethyl]dibenzofuran (PubChem CID 21443872) has the molecular formula C22H30O11P2 and a molecular weight of 532.42 g/mol. Its IUPAC name is 1,2-bis[bis(ethylperoxy)phosphorylmethyl]dibenzofuran.
| Compound Name | 1,2-bis[bis(ethylperoxy)phosphorylmethyl]dibenzofuran |
|---|---|
| PubChem CID | 21443872 |
| Molecular Formula | C22H30O11P2 |
| Molecular Weight | 532.42 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | 1,2-bis[bis(ethylperoxy)phosphorylmethyl]dibenzofuran |
| SMILES | CCOOP(=O)(Cc1ccc2oc3ccccc3c2c1CP(=O)(OOCC)OOCC)OOCC |
| InChI | InChI=1S/C22H30O11P2/c1-5-25-30-34(23,31-26-6-2)15-17-13-14-21-22(18-11-9-10-12-20(18)29-21)19(17)16-35(24,32-27-7-3)33-28-8-4/h9-14H,5-8,15-16H2,1-4H3 |
| InChIKey | YIQYMCUGVQAQDI-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 121.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.42 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|