About 6-cyclohexyloxy-3,4-dihydro-2H-naphthalen-1-one
6-cyclohexyloxy-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 21444523) has the molecular formula C16H20O2
and a molecular weight of 244.33 g/mol. Its IUPAC name is 6-cyclohexyloxy-3,4-dihydro-2H-naphthalen-1-one.
Molecular Properties
| Compound Name | 6-cyclohexyloxy-3,4-dihydro-2H-naphthalen-1-one |
| PubChem CID | 21444523 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 6-cyclohexyloxy-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1CCCc2cc(OC3CCCCC3)ccc21 |
| InChI | InChI=1S/C16H20O2/c17-16-8-4-5-12-11-14(9-10-15(12)16)18-13-6-2-1-3-7-13/h9-11,13H,1-8H2 |
| InChIKey | KXQBFGQTUMLDPP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-cyclohexyloxy-3,4-dihydro-2H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclohexyloxy-3,4-dihydro-2H-naphthalen-1-one?
The IUPAC name of 6-cyclohexyloxy-3,4-dihydro-2H-naphthalen-1-one (CID 21444523) is 6-cyclohexyloxy-3,4-dihydro-2H-naphthalen-1-one.
What is the SMILES notation for 6-cyclohexyloxy-3,4-dihydro-2H-naphthalen-1-one?
The canonical SMILES for 6-cyclohexyloxy-3,4-dihydro-2H-naphthalen-1-one is O=C1CCCc2cc(OC3CCCCC3)ccc21.
What is the InChIKey of 6-cyclohexyloxy-3,4-dihydro-2H-naphthalen-1-one?
The InChIKey is KXQBFGQTUMLDPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O2/c17-16-8-4-5-12-11-14(9-10-15(12)16)18-13-6-2-1-3-7-13/h9-11,13H,1-8H2.
What are the key properties of 6-cyclohexyloxy-3,4-dihydro-2H-naphthalen-1-one?
6-cyclohexyloxy-3,4-dihydro-2H-naphthalen-1-one has a molecular weight of 244.33 g/mol, XLogP of 3.92, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclohexyloxy-3,4-dihydro-2H-naphthalen-1-one is sourced from PubChem (CID 21444523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).