About 2-oxo-1,3-diazepane-1-carbonyl chloride
2-oxo-1,3-diazepane-1-carbonyl chloride (PubChem CID 21444840) has the molecular formula C6H9ClN2O2
and a molecular weight of 176.60 g/mol. Its IUPAC name is 2-oxo-1,3-diazepane-1-carbonyl chloride.
Molecular Properties
| Compound Name | 2-oxo-1,3-diazepane-1-carbonyl chloride |
| PubChem CID | 21444840 |
| Molecular Formula | C6H9ClN2O2 |
| Molecular Weight | 176.60 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 2-oxo-1,3-diazepane-1-carbonyl chloride |
| SMILES | O=C(Cl)N1CCCCNC1=O |
| InChI | InChI=1S/C6H9ClN2O2/c7-5(10)9-4-2-1-3-8-6(9)11/h1-4H2,(H,8,11) |
| InChIKey | FOYPWTVSNASFEJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.60 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-1,3-diazepane-1-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-1,3-diazepane-1-carbonyl chloride?
The IUPAC name of 2-oxo-1,3-diazepane-1-carbonyl chloride (CID 21444840) is 2-oxo-1,3-diazepane-1-carbonyl chloride.
What is the SMILES notation for 2-oxo-1,3-diazepane-1-carbonyl chloride?
The canonical SMILES for 2-oxo-1,3-diazepane-1-carbonyl chloride is O=C(Cl)N1CCCCNC1=O.
What is the InChIKey of 2-oxo-1,3-diazepane-1-carbonyl chloride?
The InChIKey is FOYPWTVSNASFEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClN2O2/c7-5(10)9-4-2-1-3-8-6(9)11/h1-4H2,(H,8,11).
What are the key properties of 2-oxo-1,3-diazepane-1-carbonyl chloride?
2-oxo-1,3-diazepane-1-carbonyl chloride has a molecular weight of 176.60 g/mol, XLogP of 1.15, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-1,3-diazepane-1-carbonyl chloride is sourced from PubChem (CID 21444840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).