C12H18N4O2S — CID 21445102
2-ethyl-5-nitro-N-propan-2-yl-6-prop-2-enylsulfanylpyrimidin-4-amine (PubChem CID 21445102) has the molecular formula C12H18N4O2S and a molecular weight of 282.37 g/mol. Its IUPAC name is 2-ethyl-5-nitro-N-propan-2-yl-6-prop-2-enylsulfanylpyrimidin-4-amine.
| Compound Name | 2-ethyl-5-nitro-N-propan-2-yl-6-prop-2-enylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 21445102 |
| Molecular Formula | C12H18N4O2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-ethyl-5-nitro-N-propan-2-yl-6-prop-2-enylsulfanylpyrimidin-4-amine |
| SMILES | C=CCSc1nc(CC)nc(NC(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H18N4O2S/c1-5-7-19-12-10(16(17)18)11(13-8(3)4)14-9(6-2)15-12/h5,8H,1,6-7H2,2-4H3,(H,13,14,15) |
| InChIKey | IMBZBLKXLPGDOB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|