C21H21Cl2N3 — CID 21445432
2-(2,6-dichloroindolo[2,3-c]quinolin-7-yl)-N,N-diethylethanamine (PubChem CID 21445432) has the molecular formula C21H21Cl2N3 and a molecular weight of 386.33 g/mol. Its IUPAC name is 2-(2,6-dichloroindolo[2,3-c]quinolin-7-yl)-N,N-diethylethanamine.
| Compound Name | 2-(2,6-dichloroindolo[2,3-c]quinolin-7-yl)-N,N-diethylethanamine |
|---|---|
| PubChem CID | 21445432 |
| Molecular Formula | C21H21Cl2N3 |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 2-(2,6-dichloroindolo[2,3-c]quinolin-7-yl)-N,N-diethylethanamine |
| SMILES | CCN(CC)CCn1c2ccccc2c2c3cc(Cl)ccc3nc(Cl)c21 |
| InChI | InChI=1S/C21H21Cl2N3/c1-3-25(4-2)11-12-26-18-8-6-5-7-15(18)19-16-13-14(22)9-10-17(16)24-21(23)20(19)26/h5-10,13H,3-4,11-12H2,1-2H3 |
| InChIKey | LEPCYOAFDJGQFT-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|