About 5,7-bis[2-(diethylamino)ethyl]indolo[2,3-c]quinolin-6-one
5,7-bis[2-(diethylamino)ethyl]indolo[2,3-c]quinolin-6-one (PubChem CID 21445442) has the molecular formula C27H36N4O
and a molecular weight of 432.61 g/mol. Its IUPAC name is 5,7-bis[2-(diethylamino)ethyl]indolo[2,3-c]quinolin-6-one.
Molecular Properties
| Compound Name | 5,7-bis[2-(diethylamino)ethyl]indolo[2,3-c]quinolin-6-one |
| PubChem CID | 21445442 |
| Molecular Formula | C27H36N4O |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | 5,7-bis[2-(diethylamino)ethyl]indolo[2,3-c]quinolin-6-one |
| SMILES | CCN(CC)CCn1c(=O)c2c(c3ccccc31)c1ccccc1n2CCN(CC)CC |
| InChI | InChI=1S/C27H36N4O/c1-5-28(6-2)17-19-30-23-15-11-9-13-21(23)25-22-14-10-12-16-24(22)31(27(32)26(25)30)20-18-29(7-3)8-4/h9-16H,5-8,17-20H2,1-4H3 |
| InChIKey | RZPMKWWIJMDVKX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 33.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5,7-bis[2-(diethylamino)ethyl]indolo[2,3-c]quinolin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-bis[2-(diethylamino)ethyl]indolo[2,3-c]quinolin-6-one?
The IUPAC name of 5,7-bis[2-(diethylamino)ethyl]indolo[2,3-c]quinolin-6-one (CID 21445442) is 5,7-bis[2-(diethylamino)ethyl]indolo[2,3-c]quinolin-6-one.
What is the SMILES notation for 5,7-bis[2-(diethylamino)ethyl]indolo[2,3-c]quinolin-6-one?
The canonical SMILES for 5,7-bis[2-(diethylamino)ethyl]indolo[2,3-c]quinolin-6-one is CCN(CC)CCn1c(=O)c2c(c3ccccc31)c1ccccc1n2CCN(CC)CC.
What is the InChIKey of 5,7-bis[2-(diethylamino)ethyl]indolo[2,3-c]quinolin-6-one?
The InChIKey is RZPMKWWIJMDVKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H36N4O/c1-5-28(6-2)17-19-30-23-15-11-9-13-21(23)25-22-14-10-12-16-24(22)31(27(32)26(25)30)20-18-29(7-3)8-4/h9-16H,5-8,17-20H2,1-4H3.
What are the key properties of 5,7-bis[2-(diethylamino)ethyl]indolo[2,3-c]quinolin-6-one?
5,7-bis[2-(diethylamino)ethyl]indolo[2,3-c]quinolin-6-one has a molecular weight of 432.61 g/mol, XLogP of 4.79, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-bis[2-(diethylamino)ethyl]indolo[2,3-c]quinolin-6-one is sourced from PubChem (CID 21445442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).