C21H24ClN5 — CID 21445472
2-(10-chloro-6-hydrazinylindolo[2,3-c]quinolin-7-yl)-N,N-diethylethanamine (PubChem CID 21445472) has the molecular formula C21H24ClN5 and a molecular weight of 381.91 g/mol. Its IUPAC name is 2-(10-chloro-6-hydrazinylindolo[2,3-c]quinolin-7-yl)-N,N-diethylethanamine.
| Compound Name | 2-(10-chloro-6-hydrazinylindolo[2,3-c]quinolin-7-yl)-N,N-diethylethanamine |
|---|---|
| PubChem CID | 21445472 |
| Molecular Formula | C21H24ClN5 |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 2-(10-chloro-6-hydrazinylindolo[2,3-c]quinolin-7-yl)-N,N-diethylethanamine |
| SMILES | CCN(CC)CCn1c2ccc(Cl)cc2c2c3ccccc3nc(NN)c21 |
| InChI | InChI=1S/C21H24ClN5/c1-3-26(4-2)11-12-27-18-10-9-14(22)13-16(18)19-15-7-5-6-8-17(15)24-21(25-23)20(19)27/h5-10,13H,3-4,11-12,23H2,1-2H3,(H,24,25) |
| InChIKey | URWFDJGGIKJXDT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|