About 4-amino-1-[(Z)-2,3-diphenylprop-2-enyl]pyrimidin-2-one
4-amino-1-[(Z)-2,3-diphenylprop-2-enyl]pyrimidin-2-one (PubChem CID 21446833) has the molecular formula C19H17N3O
and a molecular weight of 303.37 g/mol. Its IUPAC name is 4-amino-1-[(Z)-2,3-diphenylprop-2-enyl]pyrimidin-2-one.
Molecular Properties
| Compound Name | 4-amino-1-[(Z)-2,3-diphenylprop-2-enyl]pyrimidin-2-one |
| PubChem CID | 21446833 |
| Molecular Formula | C19H17N3O |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 4-amino-1-[(Z)-2,3-diphenylprop-2-enyl]pyrimidin-2-one |
| SMILES | Nc1ccn(C/C(=C\c2ccccc2)c2ccccc2)c(=O)n1 |
| InChI | InChI=1S/C19H17N3O/c20-18-11-12-22(19(23)21-18)14-17(16-9-5-2-6-10-16)13-15-7-3-1-4-8-15/h1-13H,14H2,(H2,20,21,23)/b17-13+ |
| InChIKey | HKCDBCKKCBQYKY-GHRIWEEISA-N |
| XLogP | 3.07 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-1-[(Z)-2,3-diphenylprop-2-enyl]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-[(Z)-2,3-diphenylprop-2-enyl]pyrimidin-2-one?
The IUPAC name of 4-amino-1-[(Z)-2,3-diphenylprop-2-enyl]pyrimidin-2-one (CID 21446833) is 4-amino-1-[(Z)-2,3-diphenylprop-2-enyl]pyrimidin-2-one.
What is the SMILES notation for 4-amino-1-[(Z)-2,3-diphenylprop-2-enyl]pyrimidin-2-one?
The canonical SMILES for 4-amino-1-[(Z)-2,3-diphenylprop-2-enyl]pyrimidin-2-one is Nc1ccn(C/C(=C\c2ccccc2)c2ccccc2)c(=O)n1.
What is the InChIKey of 4-amino-1-[(Z)-2,3-diphenylprop-2-enyl]pyrimidin-2-one?
The InChIKey is HKCDBCKKCBQYKY-GHRIWEEISA-N. The full InChI is InChI=1S/C19H17N3O/c20-18-11-12-22(19(23)21-18)14-17(16-9-5-2-6-10-16)13-15-7-3-1-4-8-15/h1-13H,14H2,(H2,20,21,23)/b17-13+.
What are the key properties of 4-amino-1-[(Z)-2,3-diphenylprop-2-enyl]pyrimidin-2-one?
4-amino-1-[(Z)-2,3-diphenylprop-2-enyl]pyrimidin-2-one has a molecular weight of 303.37 g/mol, XLogP of 3.07, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-[(Z)-2,3-diphenylprop-2-enyl]pyrimidin-2-one is sourced from PubChem (CID 21446833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).