About 4-(6-hydroxy-2-azabicyclo[2.2.2]octan-2-yl)-2,2-diphenylbutanenitrile
4-(6-hydroxy-2-azabicyclo[2.2.2]octan-2-yl)-2,2-diphenylbutanenitrile (PubChem CID 21447135) has the molecular formula C23H26N2O
and a molecular weight of 346.47 g/mol. Its IUPAC name is 4-(6-hydroxy-2-azabicyclo[2.2.2]octan-2-yl)-2,2-diphenylbutanenitrile.
Molecular Properties
| Compound Name | 4-(6-hydroxy-2-azabicyclo[2.2.2]octan-2-yl)-2,2-diphenylbutanenitrile |
| PubChem CID | 21447135 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 4-(6-hydroxy-2-azabicyclo[2.2.2]octan-2-yl)-2,2-diphenylbutanenitrile |
| SMILES | N#CC(CCN1CC2CCC1C(O)C2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H26N2O/c24-17-23(19-7-3-1-4-8-19,20-9-5-2-6-10-20)13-14-25-16-18-11-12-21(25)22(26)15-18/h1-10,18,21-22,26H,11-16H2 |
| InChIKey | SCMPNPGDMBCGBY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(6-hydroxy-2-azabicyclo[2.2.2]octan-2-yl)-2,2-diphenylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-hydroxy-2-azabicyclo[2.2.2]octan-2-yl)-2,2-diphenylbutanenitrile?
The IUPAC name of 4-(6-hydroxy-2-azabicyclo[2.2.2]octan-2-yl)-2,2-diphenylbutanenitrile (CID 21447135) is 4-(6-hydroxy-2-azabicyclo[2.2.2]octan-2-yl)-2,2-diphenylbutanenitrile.
What is the SMILES notation for 4-(6-hydroxy-2-azabicyclo[2.2.2]octan-2-yl)-2,2-diphenylbutanenitrile?
The canonical SMILES for 4-(6-hydroxy-2-azabicyclo[2.2.2]octan-2-yl)-2,2-diphenylbutanenitrile is N#CC(CCN1CC2CCC1C(O)C2)(c1ccccc1)c1ccccc1.
What is the InChIKey of 4-(6-hydroxy-2-azabicyclo[2.2.2]octan-2-yl)-2,2-diphenylbutanenitrile?
The InChIKey is SCMPNPGDMBCGBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N2O/c24-17-23(19-7-3-1-4-8-19,20-9-5-2-6-10-20)13-14-25-16-18-11-12-21(25)22(26)15-18/h1-10,18,21-22,26H,11-16H2.
What are the key properties of 4-(6-hydroxy-2-azabicyclo[2.2.2]octan-2-yl)-2,2-diphenylbutanenitrile?
4-(6-hydroxy-2-azabicyclo[2.2.2]octan-2-yl)-2,2-diphenylbutanenitrile has a molecular weight of 346.47 g/mol, XLogP of 3.73, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-hydroxy-2-azabicyclo[2.2.2]octan-2-yl)-2,2-diphenylbutanenitrile is sourced from PubChem (CID 21447135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).