methyl 3,6-dimethyl-1-benzofuran-2-carboxylate

C12H12O3 — CID 2144725

IUPACmethyl 3,6-dimethyl-1-benzofuran-2-carboxylate
SMILESCOC(=O)c1oc2cc(C)ccc2c1C
InChIInChI=1S/C12H12O3/c1-7-4-5-9-8(2)11(12(13)14-3)15-10(9)6-7/h4-6H,1-3H3
InChIKeyVZCKVTKAEPSBIS-UHFFFAOYSA-N
MW204.22 g/mol
LogP2.84
Rot. Bonds1

About methyl 3,6-dimethyl-1-benzofuran-2-carboxylate

methyl 3,6-dimethyl-1-benzofuran-2-carboxylate (PubChem CID 2144725) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is methyl 3,6-dimethyl-1-benzofuran-2-carboxylate.

Molecular Properties

Compound Namemethyl 3,6-dimethyl-1-benzofuran-2-carboxylate
PubChem CID2144725
Molecular FormulaC12H12O3
Molecular Weight204.22 g/mol
Exact Mass204.08
IUPAC Namemethyl 3,6-dimethyl-1-benzofuran-2-carboxylate
SMILESCOC(=O)c1oc2cc(C)ccc2c1C
InChIInChI=1S/C12H12O3/c1-7-4-5-9-8(2)11(12(13)14-3)15-10(9)6-7/h4-6H,1-3H3
InChIKeyVZCKVTKAEPSBIS-UHFFFAOYSA-N
XLogP2.84
TPSA39.44 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.22
LogP ≤ 52.84
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3,6-dimethyl-1-benzofuran-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,6-dimethyl-1-benzofuran-2-carboxylate?
The IUPAC name of methyl 3,6-dimethyl-1-benzofuran-2-carboxylate (CID 2144725) is methyl 3,6-dimethyl-1-benzofuran-2-carboxylate.
What is the SMILES notation for methyl 3,6-dimethyl-1-benzofuran-2-carboxylate?
The canonical SMILES for methyl 3,6-dimethyl-1-benzofuran-2-carboxylate is COC(=O)c1oc2cc(C)ccc2c1C.
What is the InChIKey of methyl 3,6-dimethyl-1-benzofuran-2-carboxylate?
The InChIKey is VZCKVTKAEPSBIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O3/c1-7-4-5-9-8(2)11(12(13)14-3)15-10(9)6-7/h4-6H,1-3H3.
What are the key properties of methyl 3,6-dimethyl-1-benzofuran-2-carboxylate?
methyl 3,6-dimethyl-1-benzofuran-2-carboxylate has a molecular weight of 204.22 g/mol, XLogP of 2.84, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,6-dimethyl-1-benzofuran-2-carboxylate is sourced from PubChem (CID 2144725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).