C10H10N2 — CID 21447262
N'-methylbicyclo[4.2.0]octa-1(8),2,4,6-tetraene-7-carboximidamide (PubChem CID 21447262) has the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. Its IUPAC name is N'-methylbicyclo[4.2.0]octa-1(8),2,4,6-tetraene-7-carboximidamide.
| Compound Name | N'-methylbicyclo[4.2.0]octa-1(8),2,4,6-tetraene-7-carboximidamide |
|---|---|
| PubChem CID | 21447262 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | N'-methylbicyclo[4.2.0]octa-1(8),2,4,6-tetraene-7-carboximidamide |
| SMILES | C/N=C(\N)C1=c2ccccc2=C1 |
| InChI | InChI=1S/C10H10N2/c1-12-10(11)9-6-7-4-2-3-5-8(7)9/h2-6H,1H3,(H2,11,12) |
| InChIKey | JARWAFZVWDIFLH-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|