About 1-amino-4-methyl-10,10a-dihydro-1H-acridin-2-one
1-amino-4-methyl-10,10a-dihydro-1H-acridin-2-one (PubChem CID 21448142) has the molecular formula C14H14N2O
and a molecular weight of 226.28 g/mol. Its IUPAC name is 1-amino-4-methyl-10,10a-dihydro-1H-acridin-2-one.
Molecular Properties
| Compound Name | 1-amino-4-methyl-10,10a-dihydro-1H-acridin-2-one |
| PubChem CID | 21448142 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 1-amino-4-methyl-10,10a-dihydro-1H-acridin-2-one |
| SMILES | CC1=CC(=O)C(N)C2=C1NC1C=CC=CC1=C2 |
| InChI | InChI=1S/C14H14N2O/c1-8-6-12(17)13(15)10-7-9-4-2-3-5-11(9)16-14(8)10/h2-7,11,13,16H,15H2,1H3 |
| InChIKey | AVXBILAZOLJPHU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-amino-4-methyl-10,10a-dihydro-1H-acridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-4-methyl-10,10a-dihydro-1H-acridin-2-one?
The IUPAC name of 1-amino-4-methyl-10,10a-dihydro-1H-acridin-2-one (CID 21448142) is 1-amino-4-methyl-10,10a-dihydro-1H-acridin-2-one.
What is the SMILES notation for 1-amino-4-methyl-10,10a-dihydro-1H-acridin-2-one?
The canonical SMILES for 1-amino-4-methyl-10,10a-dihydro-1H-acridin-2-one is CC1=CC(=O)C(N)C2=C1NC1C=CC=CC1=C2.
What is the InChIKey of 1-amino-4-methyl-10,10a-dihydro-1H-acridin-2-one?
The InChIKey is AVXBILAZOLJPHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O/c1-8-6-12(17)13(15)10-7-9-4-2-3-5-11(9)16-14(8)10/h2-7,11,13,16H,15H2,1H3.
What are the key properties of 1-amino-4-methyl-10,10a-dihydro-1H-acridin-2-one?
1-amino-4-methyl-10,10a-dihydro-1H-acridin-2-one has a molecular weight of 226.28 g/mol, XLogP of 1.12, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-4-methyl-10,10a-dihydro-1H-acridin-2-one is sourced from PubChem (CID 21448142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).