About 3-[(E)-2-(1,2,4-oxadiazol-3-yl)ethenyl]aniline
3-[(E)-2-(1,2,4-oxadiazol-3-yl)ethenyl]aniline (PubChem CID 21448290) has the molecular formula C10H9N3O
and a molecular weight of 187.20 g/mol. Its IUPAC name is 3-[(E)-2-(1,2,4-oxadiazol-3-yl)ethenyl]aniline.
Molecular Properties
| Compound Name | 3-[(E)-2-(1,2,4-oxadiazol-3-yl)ethenyl]aniline |
| PubChem CID | 21448290 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 3-[(E)-2-(1,2,4-oxadiazol-3-yl)ethenyl]aniline |
| SMILES | Nc1cccc(/C=C/c2ncon2)c1 |
| InChI | InChI=1S/C10H9N3O/c11-9-3-1-2-8(6-9)4-5-10-12-7-14-13-10/h1-7H,11H2/b5-4+ |
| InChIKey | MNMUEUXICYJDOK-SNAWJCMRSA-N |
| XLogP | 1.82 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-2-(1,2,4-oxadiazol-3-yl)ethenyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-2-(1,2,4-oxadiazol-3-yl)ethenyl]aniline?
The IUPAC name of 3-[(E)-2-(1,2,4-oxadiazol-3-yl)ethenyl]aniline (CID 21448290) is 3-[(E)-2-(1,2,4-oxadiazol-3-yl)ethenyl]aniline.
What is the SMILES notation for 3-[(E)-2-(1,2,4-oxadiazol-3-yl)ethenyl]aniline?
The canonical SMILES for 3-[(E)-2-(1,2,4-oxadiazol-3-yl)ethenyl]aniline is Nc1cccc(/C=C/c2ncon2)c1.
What is the InChIKey of 3-[(E)-2-(1,2,4-oxadiazol-3-yl)ethenyl]aniline?
The InChIKey is MNMUEUXICYJDOK-SNAWJCMRSA-N. The full InChI is InChI=1S/C10H9N3O/c11-9-3-1-2-8(6-9)4-5-10-12-7-14-13-10/h1-7H,11H2/b5-4+.
What are the key properties of 3-[(E)-2-(1,2,4-oxadiazol-3-yl)ethenyl]aniline?
3-[(E)-2-(1,2,4-oxadiazol-3-yl)ethenyl]aniline has a molecular weight of 187.20 g/mol, XLogP of 1.82, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-2-(1,2,4-oxadiazol-3-yl)ethenyl]aniline is sourced from PubChem (CID 21448290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).