About 1-phenyl-6-(2,3,3-trichloroprop-2-enylsulfanyl)pyridazin-1-ium-4-amine chloride
1-phenyl-6-(2,3,3-trichloroprop-2-enylsulfanyl)pyridazin-1-ium-4-amine chloride (PubChem CID 21449857) has the molecular formula C13H11Cl4N3S
and a molecular weight of 383.13 g/mol. Its IUPAC name is 1-phenyl-6-(2,3,3-trichloroprop-2-enylsulfanyl)pyridazin-1-ium-4-amine chloride.
Molecular Properties
| Compound Name | 1-phenyl-6-(2,3,3-trichloroprop-2-enylsulfanyl)pyridazin-1-ium-4-amine chloride |
| PubChem CID | 21449857 |
| Molecular Formula | C13H11Cl4N3S |
| Molecular Weight | 383.13 g/mol |
| Exact Mass | 380.94 |
| IUPAC Name | 1-phenyl-6-(2,3,3-trichloroprop-2-enylsulfanyl)pyridazin-1-ium-4-amine chloride |
| SMILES | Nc1cn[n+](-c2ccccc2)c(SCC(Cl)=C(Cl)Cl)c1.[Cl-] |
| InChI | InChI=1S/C13H10Cl3N3S.ClH/c14-11(13(15)16)8-20-12-6-9(17)7-18-19(12)10-4-2-1-3-5-10;/h1-7,17H,8H2;1H |
| InChIKey | SIVSNTWACGDCFN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 42.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.13 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-6-(2,3,3-trichloroprop-2-enylsulfanyl)pyridazin-1-ium-4-amine chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-6-(2,3,3-trichloroprop-2-enylsulfanyl)pyridazin-1-ium-4-amine chloride?
The IUPAC name of 1-phenyl-6-(2,3,3-trichloroprop-2-enylsulfanyl)pyridazin-1-ium-4-amine chloride (CID 21449857) is 1-phenyl-6-(2,3,3-trichloroprop-2-enylsulfanyl)pyridazin-1-ium-4-amine chloride.
What is the SMILES notation for 1-phenyl-6-(2,3,3-trichloroprop-2-enylsulfanyl)pyridazin-1-ium-4-amine chloride?
The canonical SMILES for 1-phenyl-6-(2,3,3-trichloroprop-2-enylsulfanyl)pyridazin-1-ium-4-amine chloride is Nc1cn[n+](-c2ccccc2)c(SCC(Cl)=C(Cl)Cl)c1.[Cl-].
What is the InChIKey of 1-phenyl-6-(2,3,3-trichloroprop-2-enylsulfanyl)pyridazin-1-ium-4-amine chloride?
The InChIKey is SIVSNTWACGDCFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl3N3S.ClH/c14-11(13(15)16)8-20-12-6-9(17)7-18-19(12)10-4-2-1-3-5-10;/h1-7,17H,8H2;1H.
What are the key properties of 1-phenyl-6-(2,3,3-trichloroprop-2-enylsulfanyl)pyridazin-1-ium-4-amine chloride?
1-phenyl-6-(2,3,3-trichloroprop-2-enylsulfanyl)pyridazin-1-ium-4-amine chloride has a molecular weight of 383.13 g/mol, XLogP of 0.92, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-6-(2,3,3-trichloroprop-2-enylsulfanyl)pyridazin-1-ium-4-amine chloride is sourced from PubChem (CID 21449857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).