About N-(cyclohexylmethyliminomethyl)-N'-(2,4-dimethylphenyl)-N-methylmethanimidamide
N-(cyclohexylmethyliminomethyl)-N'-(2,4-dimethylphenyl)-N-methylmethanimidamide (PubChem CID 21450514) has the molecular formula C18H27N3
and a molecular weight of 285.44 g/mol. Its IUPAC name is N-(cyclohexylmethyliminomethyl)-N'-(2,4-dimethylphenyl)-N-methylmethanimidamide.
Molecular Properties
| Compound Name | N-(cyclohexylmethyliminomethyl)-N'-(2,4-dimethylphenyl)-N-methylmethanimidamide |
| PubChem CID | 21450514 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | N-(cyclohexylmethyliminomethyl)-N'-(2,4-dimethylphenyl)-N-methylmethanimidamide |
| SMILES | Cc1ccc(/N=C/N(C)/C=N/CC2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C18H27N3/c1-15-9-10-18(16(2)11-15)20-14-21(3)13-19-12-17-7-5-4-6-8-17/h9-11,13-14,17H,4-8,12H2,1-3H3/b19-13+,20-14+ |
| InChIKey | ACEKOLJMQPVGLI-IWGRKNQJSA-N |
| XLogP | 4.50 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(cyclohexylmethyliminomethyl)-N'-(2,4-dimethylphenyl)-N-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexylmethyliminomethyl)-N'-(2,4-dimethylphenyl)-N-methylmethanimidamide?
The IUPAC name of N-(cyclohexylmethyliminomethyl)-N'-(2,4-dimethylphenyl)-N-methylmethanimidamide (CID 21450514) is N-(cyclohexylmethyliminomethyl)-N'-(2,4-dimethylphenyl)-N-methylmethanimidamide.
What is the SMILES notation for N-(cyclohexylmethyliminomethyl)-N'-(2,4-dimethylphenyl)-N-methylmethanimidamide?
The canonical SMILES for N-(cyclohexylmethyliminomethyl)-N'-(2,4-dimethylphenyl)-N-methylmethanimidamide is Cc1ccc(/N=C/N(C)/C=N/CC2CCCCC2)c(C)c1.
What is the InChIKey of N-(cyclohexylmethyliminomethyl)-N'-(2,4-dimethylphenyl)-N-methylmethanimidamide?
The InChIKey is ACEKOLJMQPVGLI-IWGRKNQJSA-N. The full InChI is InChI=1S/C18H27N3/c1-15-9-10-18(16(2)11-15)20-14-21(3)13-19-12-17-7-5-4-6-8-17/h9-11,13-14,17H,4-8,12H2,1-3H3/b19-13+,20-14+.
What are the key properties of N-(cyclohexylmethyliminomethyl)-N'-(2,4-dimethylphenyl)-N-methylmethanimidamide?
N-(cyclohexylmethyliminomethyl)-N'-(2,4-dimethylphenyl)-N-methylmethanimidamide has a molecular weight of 285.44 g/mol, XLogP of 4.50, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexylmethyliminomethyl)-N'-(2,4-dimethylphenyl)-N-methylmethanimidamide is sourced from PubChem (CID 21450514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).