About 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-ethyloxolan-2-one
5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-ethyloxolan-2-one (PubChem CID 21450756) has the molecular formula C17H28O4
and a molecular weight of 296.41 g/mol. Its IUPAC name is 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-ethyloxolan-2-one.
Molecular Properties
| Compound Name | 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-ethyloxolan-2-one |
| PubChem CID | 21450756 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-ethyloxolan-2-one |
| SMILES | CCC1(CCCC2=CCC(OC)(OC)CC2)CCC(=O)O1 |
| InChI | InChI=1S/C17H28O4/c1-4-16(11-9-15(18)21-16)10-5-6-14-7-12-17(19-2,20-3)13-8-14/h7H,4-6,8-13H2,1-3H3 |
| InChIKey | AWVZEIUVVDEMKU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-ethyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-ethyloxolan-2-one?
The IUPAC name of 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-ethyloxolan-2-one (CID 21450756) is 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-ethyloxolan-2-one.
What is the SMILES notation for 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-ethyloxolan-2-one?
The canonical SMILES for 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-ethyloxolan-2-one is CCC1(CCCC2=CCC(OC)(OC)CC2)CCC(=O)O1.
What is the InChIKey of 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-ethyloxolan-2-one?
The InChIKey is AWVZEIUVVDEMKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O4/c1-4-16(11-9-15(18)21-16)10-5-6-14-7-12-17(19-2,20-3)13-8-14/h7H,4-6,8-13H2,1-3H3.
What are the key properties of 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-ethyloxolan-2-one?
5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-ethyloxolan-2-one has a molecular weight of 296.41 g/mol, XLogP of 3.74, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-ethyloxolan-2-one is sourced from PubChem (CID 21450756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).