About 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-methyloxolan-2-one
5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-methyloxolan-2-one (PubChem CID 21450760) has the molecular formula C16H26O4
and a molecular weight of 282.38 g/mol. Its IUPAC name is 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-methyloxolan-2-one.
Molecular Properties
| Compound Name | 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-methyloxolan-2-one |
| PubChem CID | 21450760 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-methyloxolan-2-one |
| SMILES | COC1(OC)CC=C(CCCC2(C)CCC(=O)O2)CC1 |
| InChI | InChI=1S/C16H26O4/c1-15(10-8-14(17)20-15)9-4-5-13-6-11-16(18-2,19-3)12-7-13/h6H,4-5,7-12H2,1-3H3 |
| InChIKey | QDMHAGXXRKFEPS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-methyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-methyloxolan-2-one?
The IUPAC name of 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-methyloxolan-2-one (CID 21450760) is 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-methyloxolan-2-one.
What is the SMILES notation for 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-methyloxolan-2-one?
The canonical SMILES for 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-methyloxolan-2-one is COC1(OC)CC=C(CCCC2(C)CCC(=O)O2)CC1.
What is the InChIKey of 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-methyloxolan-2-one?
The InChIKey is QDMHAGXXRKFEPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O4/c1-15(10-8-14(17)20-15)9-4-5-13-6-11-16(18-2,19-3)12-7-13/h6H,4-5,7-12H2,1-3H3.
What are the key properties of 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-methyloxolan-2-one?
5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-methyloxolan-2-one has a molecular weight of 282.38 g/mol, XLogP of 3.35, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(4,4-dimethoxycyclohexen-1-yl)propyl]-5-methyloxolan-2-one is sourced from PubChem (CID 21450760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).