C14H19N2O2- — CID 21451098
2-[cyclohexyl(ethyl)amino]pyridine-3-carboxylate (PubChem CID 21451098) has the molecular formula C14H19N2O2- and a molecular weight of 247.32 g/mol. Its IUPAC name is 2-[cyclohexyl(ethyl)amino]pyridine-3-carboxylate.
| Compound Name | 2-[cyclohexyl(ethyl)amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 21451098 |
| Molecular Formula | C14H19N2O2- |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 2-[cyclohexyl(ethyl)amino]pyridine-3-carboxylate |
| SMILES | CCN(c1ncccc1C(=O)[O-])C1CCCCC1 |
| InChI | InChI=1S/C14H20N2O2/c1-2-16(11-7-4-3-5-8-11)13-12(14(17)18)9-6-10-15-13/h6,9-11H,2-5,7-8H2,1H3,(H,17,18)/p-1 |
| InChIKey | ZGPLSHBOQNETHB-UHFFFAOYSA-M |
| XLogP | 1.60 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |