About 1-spiro[2,4-dihydro-1H-naphthalene-3,4'-cyclohexane]-1'-ylazepane
1-spiro[2,4-dihydro-1H-naphthalene-3,4'-cyclohexane]-1'-ylazepane (PubChem CID 21451140) has the molecular formula C21H31N
and a molecular weight of 297.49 g/mol. Its IUPAC name is 1-spiro[2,4-dihydro-1H-naphthalene-3,4'-cyclohexane]-1'-ylazepane.
Molecular Properties
| Compound Name | 1-spiro[2,4-dihydro-1H-naphthalene-3,4'-cyclohexane]-1'-ylazepane |
| PubChem CID | 21451140 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | 1-spiro[2,4-dihydro-1H-naphthalene-3,4'-cyclohexane]-1'-ylazepane |
| SMILES | c1ccc2c(c1)CCC1(CCC(N3CCCCCC3)CC1)C2 |
| InChI | InChI=1S/C21H31N/c1-2-6-16-22(15-5-1)20-10-13-21(14-11-20)12-9-18-7-3-4-8-19(18)17-21/h3-4,7-8,20H,1-2,5-6,9-17H2 |
| InChIKey | UPQFAYOEXWOMFA-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-spiro[2,4-dihydro-1H-naphthalene-3,4'-cyclohexane]-1'-ylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-spiro[2,4-dihydro-1H-naphthalene-3,4'-cyclohexane]-1'-ylazepane?
The IUPAC name of 1-spiro[2,4-dihydro-1H-naphthalene-3,4'-cyclohexane]-1'-ylazepane (CID 21451140) is 1-spiro[2,4-dihydro-1H-naphthalene-3,4'-cyclohexane]-1'-ylazepane.
What is the SMILES notation for 1-spiro[2,4-dihydro-1H-naphthalene-3,4'-cyclohexane]-1'-ylazepane?
The canonical SMILES for 1-spiro[2,4-dihydro-1H-naphthalene-3,4'-cyclohexane]-1'-ylazepane is c1ccc2c(c1)CCC1(CCC(N3CCCCCC3)CC1)C2.
What is the InChIKey of 1-spiro[2,4-dihydro-1H-naphthalene-3,4'-cyclohexane]-1'-ylazepane?
The InChIKey is UPQFAYOEXWOMFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31N/c1-2-6-16-22(15-5-1)20-10-13-21(14-11-20)12-9-18-7-3-4-8-19(18)17-21/h3-4,7-8,20H,1-2,5-6,9-17H2.
What are the key properties of 1-spiro[2,4-dihydro-1H-naphthalene-3,4'-cyclohexane]-1'-ylazepane?
1-spiro[2,4-dihydro-1H-naphthalene-3,4'-cyclohexane]-1'-ylazepane has a molecular weight of 297.49 g/mol, XLogP of 4.98, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-spiro[2,4-dihydro-1H-naphthalene-3,4'-cyclohexane]-1'-ylazepane is sourced from PubChem (CID 21451140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).