C19H29NO3 — CID 21451172
6-(3-cyclohexylpropylamino)-5,6,7,8-tetrahydronaphthalene-1,2,5-triol (PubChem CID 21451172) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is 6-(3-cyclohexylpropylamino)-5,6,7,8-tetrahydronaphthalene-1,2,5-triol.
| Compound Name | 6-(3-cyclohexylpropylamino)-5,6,7,8-tetrahydronaphthalene-1,2,5-triol |
|---|---|
| PubChem CID | 21451172 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 6-(3-cyclohexylpropylamino)-5,6,7,8-tetrahydronaphthalene-1,2,5-triol |
| SMILES | Oc1ccc2c(c1O)CCC(NCCCC1CCCCC1)C2O |
| InChI | InChI=1S/C19H29NO3/c21-17-11-9-14-15(19(17)23)8-10-16(18(14)22)20-12-4-7-13-5-2-1-3-6-13/h9,11,13,16,18,20-23H,1-8,10,12H2 |
| InChIKey | SNODKFUWWKVFFB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|