C10H4BrF9O3S — CID 21451212
[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] 4-bromobenzenesulfonate (PubChem CID 21451212) has the molecular formula C10H4BrF9O3S and a molecular weight of 455.09 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] 4-bromobenzenesulfonate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] 4-bromobenzenesulfonate |
|---|---|
| PubChem CID | 21451212 |
| Molecular Formula | C10H4BrF9O3S |
| Molecular Weight | 455.09 g/mol |
| Exact Mass | 453.89 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] 4-bromobenzenesulfonate |
| SMILES | O=S(=O)(OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H4BrF9O3S/c11-5-1-3-6(4-2-5)24(21,22)23-7(8(12,13)14,9(15,16)17)10(18,19)20/h1-4H |
| InChIKey | ZDWSKOFCDFWVTN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.09 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|