C25H31N5 — CID 21451309
8-ethyl-7-phenyl-1,4-di(piperidin-1-yl)pyrido[3,4-d]pyridazine (PubChem CID 21451309) has the molecular formula C25H31N5 and a molecular weight of 401.56 g/mol. Its IUPAC name is 8-ethyl-7-phenyl-1,4-di(piperidin-1-yl)pyrido[3,4-d]pyridazine.
| Compound Name | 8-ethyl-7-phenyl-1,4-di(piperidin-1-yl)pyrido[3,4-d]pyridazine |
|---|---|
| PubChem CID | 21451309 |
| Molecular Formula | C25H31N5 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | 8-ethyl-7-phenyl-1,4-di(piperidin-1-yl)pyrido[3,4-d]pyridazine |
| SMILES | CCc1c(-c2ccccc2)ncc2c(N3CCCCC3)nnc(N3CCCCC3)c12 |
| InChI | InChI=1S/C25H31N5/c1-2-20-22-21(18-26-23(20)19-12-6-3-7-13-19)24(29-14-8-4-9-15-29)27-28-25(22)30-16-10-5-11-17-30/h3,6-7,12-13,18H,2,4-5,8-11,14-17H2,1H3 |
| InChIKey | QGDIJTVAHKUPJH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |